C21H22Cl2N4O2 — CID 144982115
chloromethane;N-[[4-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 144982115) has the molecular formula C21H22Cl2N4O2 and a molecular weight of 433.34 g/mol. Its IUPAC name is chloromethane;N-[[4-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | chloromethane;N-[[4-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144982115 |
| Molecular Formula | C21H22Cl2N4O2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | chloromethane;N-[[4-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCl.O=C(NCc1ccc(-c2nnc(-c3ccc(Cl)cc3)o2)cc1)C1CCCN1 |
| InChI | InChI=1S/C20H19ClN4O2.CH3Cl/c21-16-9-7-15(8-10-16)20-25-24-19(27-20)14-5-3-13(4-6-14)12-23-18(26)17-2-1-11-22-17;1-2/h3-10,17,22H,1-2,11-12H2,(H,23,26);1H3 |
| InChIKey | AELDCABPNABSHI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|