C28H34FN3O5 — CID 144982516
(Z)-1-methoxyprop-1-ene;methyl 2-[3-(6-aminonaphthalen-2-yl)-4-fluoro-2-methoxy-5-(methylcarbamoylamino)phenyl]-2-methylpropanoate (PubChem CID 144982516) has the molecular formula C28H34FN3O5 and a molecular weight of 511.59 g/mol. Its IUPAC name is (Z)-1-methoxyprop-1-ene;methyl 2-[3-(6-aminonaphthalen-2-yl)-4-fluoro-2-methoxy-5-(methylcarbamoylamino)phenyl]-2-methylpropanoate.
| Compound Name | (Z)-1-methoxyprop-1-ene;methyl 2-[3-(6-aminonaphthalen-2-yl)-4-fluoro-2-methoxy-5-(methylcarbamoylamino)phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 144982516 |
| Molecular Formula | C28H34FN3O5 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (Z)-1-methoxyprop-1-ene;methyl 2-[3-(6-aminonaphthalen-2-yl)-4-fluoro-2-methoxy-5-(methylcarbamoylamino)phenyl]-2-methylpropanoate |
| SMILES | C/C=C\OC.CNC(=O)Nc1cc(C(C)(C)C(=O)OC)c(OC)c(-c2ccc3cc(N)ccc3c2)c1F |
| InChI | InChI=1S/C24H26FN3O4.C4H8O/c1-24(2,22(29)32-5)17-12-18(28-23(30)27-3)20(25)19(21(17)31-4)15-7-6-14-11-16(26)9-8-13(14)10-15;1-3-4-5-2/h6-12H,26H2,1-5H3,(H2,27,28,30);3-4H,1-2H3/b;4-3- |
| InChIKey | HZSGKWAAZCMXAP-QGAMPUOQSA-N |
| XLogP | 5.61 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|