C14H27BN2O4 — CID 144982679
ethane;methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate (PubChem CID 144982679) has the molecular formula C14H27BN2O4 and a molecular weight of 298.19 g/mol. Its IUPAC name is ethane;methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate.
| Compound Name | ethane;methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 144982679 |
| Molecular Formula | C14H27BN2O4 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | ethane;methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
| SMILES | CC.COC(=O)C1C=C(B2OC(C)(C)C(C)(C)O2)N(C)N1 |
| InChI | InChI=1S/C12H21BN2O4.C2H6/c1-11(2)12(3,4)19-13(18-11)9-7-8(10(16)17-6)14-15(9)5;1-2/h7-8,14H,1-6H3;1-2H3 |
| InChIKey | QDRIDKAPIIASGE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|