C22H32O4 — CID 144982774
acetylene;ethane;2-[(2E,4Z,8E,9Z)-8-ethylidene-7-oxoundeca-2,4,9-trien-3-yl]oxyethyl prop-2-enoate (PubChem CID 144982774) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is acetylene;ethane;2-[(2E,4Z,8E,9Z)-8-ethylidene-7-oxoundeca-2,4,9-trien-3-yl]oxyethyl prop-2-enoate.
| Compound Name | acetylene;ethane;2-[(2E,4Z,8E,9Z)-8-ethylidene-7-oxoundeca-2,4,9-trien-3-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 144982774 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | acetylene;ethane;2-[(2E,4Z,8E,9Z)-8-ethylidene-7-oxoundeca-2,4,9-trien-3-yl]oxyethyl prop-2-enoate |
| SMILES | C#C.C=CC(=O)OCCOC(/C=C\CC(=O)C(/C=C\C)=C/C)=C/C.CC |
| InChI | InChI=1S/C18H24O4.C2H6.C2H2/c1-5-10-15(6-2)17(19)12-9-11-16(7-3)21-13-14-22-18(20)8-4;2*1-2/h5-11H,4,12-14H2,1-3H3;1-2H3;1-2H/b10-5-,11-9-,15-6+,16-7+;; |
| InChIKey | FUNRDMLBDPBVFJ-ZAOMPKDHSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|