About 2,7-dimethylthionine
2,7-dimethylthionine (PubChem CID 144983268) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 2,7-dimethylthionine.
Molecular Properties
| Compound Name | 2,7-dimethylthionine |
| PubChem CID | 144983268 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2,7-dimethylthionine |
| SMILES | Cc1ccccc(C)scc1 |
| InChI | InChI=1S/C10H12S/c1-9-5-3-4-6-10(2)11-8-7-9/h3-8H,1-2H3/b4-3-,8-7-,9-5-,10-6- |
| InChIKey | JGSOFMOEHSJCRX-SKBVENDYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dimethylthionine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylthionine?
The IUPAC name of 2,7-dimethylthionine (CID 144983268) is 2,7-dimethylthionine.
What is the SMILES notation for 2,7-dimethylthionine?
The canonical SMILES for 2,7-dimethylthionine is Cc1ccccc(C)scc1.
What is the InChIKey of 2,7-dimethylthionine?
The InChIKey is JGSOFMOEHSJCRX-SKBVENDYSA-N. The full InChI is InChI=1S/C10H12S/c1-9-5-3-4-6-10(2)11-8-7-9/h3-8H,1-2H3/b4-3-,8-7-,9-5-,10-6-.
What are the key properties of 2,7-dimethylthionine?
2,7-dimethylthionine has a molecular weight of 164.27 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylthionine is sourced from PubChem (CID 144983268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).