C32H57NO — CID 144983417
1-[(5aR)-1-(1-aminoethyl)-5a,5b,8,9,11a-pentamethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]ethanone;ethane (PubChem CID 144983417) has the molecular formula C32H57NO and a molecular weight of 471.81 g/mol. Its IUPAC name is 1-[(5aR)-1-(1-aminoethyl)-5a,5b,8,9,11a-pentamethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]ethanone;ethane.
| Compound Name | 1-[(5aR)-1-(1-aminoethyl)-5a,5b,8,9,11a-pentamethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]ethanone;ethane |
|---|---|
| PubChem CID | 144983417 |
| Molecular Formula | C32H57NO |
| Molecular Weight | 471.81 g/mol |
| Exact Mass | 471.44 |
| IUPAC Name | 1-[(5aR)-1-(1-aminoethyl)-5a,5b,8,9,11a-pentamethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]ethanone;ethane |
| SMILES | CC.CC(=O)C12CCC(C(C)N)C1C1CCC3C4(C)CCC(C)C(C)C4CCC3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C30H51NO.C2H6/c1-18-10-13-27(5)23(19(18)2)12-14-29(7)25(27)9-8-24-26-22(20(3)31)11-15-30(26,21(4)32)17-16-28(24,29)6;1-2/h18-20,22-26H,8-17,31H2,1-7H3;1-2H3/t18?,19?,20?,22?,23?,24?,25?,26?,27?,28-,29?,30?;/m1./s1 |
| InChIKey | JFCIGZCLSMNXJF-CYBWCINOSA-N |
| XLogP | 8.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.81 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |