C21H31N3 — CID 144983703
2,4-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine;ethane (PubChem CID 144983703) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 2,4-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine;ethane.
| Compound Name | 2,4-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine;ethane |
|---|---|
| PubChem CID | 144983703 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 2,4-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,5-triazine;ethane |
| SMILES | C=C/C=C(\C=C/C)c1ncnc(C(/C=C\C)=C/C=C)n1.CC.CC |
| InChI | InChI=1S/C17H19N3.2C2H6/c1-5-9-14(10-6-2)16-18-13-19-17(20-16)15(11-7-3)12-8-4;2*1-2/h5-13H,1,3H2,2,4H3;2*1-2H3/b10-6-,12-8-,14-9+,15-11+;; |
| InChIKey | XJWWQTXQUBAHSZ-SXRYJNILSA-N |
| XLogP | 6.22 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|