About (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one
(5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one (PubChem CID 144983848) has the molecular formula C23H22O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one.
Molecular Properties
| Compound Name | (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one |
| PubChem CID | 144983848 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one |
| SMILES | C/C=c1/c(/C=C\CCc2cccc3ccccc23)cc(=O)o/c1=C/C |
| InChI | InChI=1S/C23H22O2/c1-3-20-19(16-23(24)25-22(20)4-2)12-6-5-10-17-13-9-14-18-11-7-8-15-21(17)18/h3-4,6-9,11-16H,5,10H2,1-2H3/b12-6-,20-3-,22-4+ |
| InChIKey | RBCQJSYAJCBINL-FTQJXYAJSA-N |
| XLogP | 4.04 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one?
The IUPAC name of (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one (CID 144983848) is (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one.
What is the SMILES notation for (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one?
The canonical SMILES for (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one is C/C=c1/c(/C=C\CCc2cccc3ccccc23)cc(=O)o/c1=C/C.
What is the InChIKey of (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one?
The InChIKey is RBCQJSYAJCBINL-FTQJXYAJSA-N. The full InChI is InChI=1S/C23H22O2/c1-3-20-19(16-23(24)25-22(20)4-2)12-6-5-10-17-13-9-14-18-11-7-8-15-21(17)18/h3-4,6-9,11-16H,5,10H2,1-2H3/b12-6-,20-3-,22-4+.
What are the key properties of (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one?
(5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one has a molecular weight of 330.43 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-5,6-di(ethylidene)-4-[(Z)-4-naphthalen-1-ylbut-1-enyl]pyran-2-one is sourced from PubChem (CID 144983848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).