C13H16F3N5O2 — CID 144984094
4-formyl-N,N-dimethyl-1-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-2-carboxamide (PubChem CID 144984094) has the molecular formula C13H16F3N5O2 and a molecular weight of 331.30 g/mol. Its IUPAC name is 4-formyl-N,N-dimethyl-1-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-2-carboxamide.
| Compound Name | 4-formyl-N,N-dimethyl-1-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 144984094 |
| Molecular Formula | C13H16F3N5O2 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-formyl-N,N-dimethyl-1-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CN(C=O)CCN1c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H16F3N5O2/c1-19(2)11(23)10-7-20(8-22)3-4-21(10)12-17-5-9(6-18-12)13(14,15)16/h5-6,8,10H,3-4,7H2,1-2H3 |
| InChIKey | XIOHPQHDMLBCBL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|