C14H13N5OS — CID 144984103
6-[[4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-yl]amino]pyridine-3-carbaldehyde (PubChem CID 144984103) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 6-[[4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-yl]amino]pyridine-3-carbaldehyde.
| Compound Name | 6-[[4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-yl]amino]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 144984103 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 6-[[4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-yl]amino]pyridine-3-carbaldehyde |
| SMILES | Cc1nn(C)cc1-c1csc(Nc2ccc(C=O)cn2)n1 |
| InChI | InChI=1S/C14H13N5OS/c1-9-11(6-19(2)18-9)12-8-21-14(16-12)17-13-4-3-10(7-20)5-15-13/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | VVQLFSQGNPUVMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|