C11H14F3N3 — CID 144984119
(Z)-5,5,5-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pent-2-ene-1,4-diimine (PubChem CID 144984119) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is (Z)-5,5,5-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pent-2-ene-1,4-diimine.
| Compound Name | (Z)-5,5,5-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pent-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 144984119 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (Z)-5,5,5-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pent-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])C(F)(F)F)C1=CCN(C)CC1 |
| InChI | InChI=1S/C11H14F3N3/c1-17-6-4-8(5-7-17)9(15)2-3-10(16)11(12,13)14/h2-4,15-16H,5-7H2,1H3/b3-2-,15-9-,16-10- |
| InChIKey | GKTOXBXJQCVDNJ-NLEVYTJASA-N |
| XLogP | 2.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|