C13H20FN — CID 144984207
2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]pyrrolidine (PubChem CID 144984207) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]pyrrolidine.
| Compound Name | 2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 144984207 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]pyrrolidine |
| SMILES | C=C(F)/C=C\C(=C)C(C)CC1CCCN1 |
| InChI | InChI=1S/C13H20FN/c1-10(6-7-12(3)14)11(2)9-13-5-4-8-15-13/h6-7,11,13,15H,1,3-5,8-9H2,2H3/b7-6- |
| InChIKey | CWZBMUBLILGYMH-SREVYHEPSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|