C43H32NOPS — CID 144984402
6-[3-[(4aS)-6-diphenylphosphoryl-4a,8a-dihydronaphthalen-2-yl]cyclohexa-1,5-dien-1-yl]-[1]benzothiolo[3,2-c]quinoline (PubChem CID 144984402) has the molecular formula C43H32NOPS and a molecular weight of 641.78 g/mol. Its IUPAC name is 6-[3-[(4aS)-6-diphenylphosphoryl-4a,8a-dihydronaphthalen-2-yl]cyclohexa-1,5-dien-1-yl]-[1]benzothiolo[3,2-c]quinoline.
| Compound Name | 6-[3-[(4aS)-6-diphenylphosphoryl-4a,8a-dihydronaphthalen-2-yl]cyclohexa-1,5-dien-1-yl]-[1]benzothiolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 144984402 |
| Molecular Formula | C43H32NOPS |
| Molecular Weight | 641.78 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | 6-[3-[(4aS)-6-diphenylphosphoryl-4a,8a-dihydronaphthalen-2-yl]cyclohexa-1,5-dien-1-yl]-[1]benzothiolo[3,2-c]quinoline |
| SMILES | O=P(C1=C[C@H]2C=CC(C3C=C(c4nc5ccccc5c5sc6ccccc6c45)C=CC3)=CC2C=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H32NOPS/c45-46(34-14-3-1-4-15-34,35-16-5-2-6-17-35)36-25-24-31-26-30(22-23-32(31)28-36)29-12-11-13-33(27-29)42-41-38-19-8-10-21-40(38)47-43(41)37-18-7-9-20-39(37)44-42/h1-11,13-29,31-32H,12H2/t29?,31?,32-/m1/s1 |
| InChIKey | SAMWZJQIKZDUQX-GFYZXZBBSA-N |
| XLogP | 10.76 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.78 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|