About ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine
ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine (PubChem CID 144985063) has the molecular formula C19H38FNO
and a molecular weight of 315.52 g/mol. Its IUPAC name is ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine.
Molecular Properties
| Compound Name | ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine |
| PubChem CID | 144985063 |
| Molecular Formula | C19H38FNO |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine |
| SMILES | C=CCCC(C)(C)OCCC(C)(C)CCCNC(=C)F.CC |
| InChI | InChI=1S/C17H32FNO.C2H6/c1-7-8-11-17(5,6)20-14-12-16(3,4)10-9-13-19-15(2)18;1-2/h7,19H,1-2,8-14H2,3-6H3;1-2H3 |
| InChIKey | OWFBZMUHBYJWSV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine?
The IUPAC name of ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine (CID 144985063) is ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine.
What is the SMILES notation for ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine?
The canonical SMILES for ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine is C=CCCC(C)(C)OCCC(C)(C)CCCNC(=C)F.CC.
What is the InChIKey of ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine?
The InChIKey is OWFBZMUHBYJWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32FNO.C2H6/c1-7-8-11-17(5,6)20-14-12-16(3,4)10-9-13-19-15(2)18;1-2/h7,19H,1-2,8-14H2,3-6H3;1-2H3.
What are the key properties of ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine?
ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine has a molecular weight of 315.52 g/mol, XLogP of 6.00, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(1-fluoroethenyl)-4,4-dimethyl-6-(2-methylhex-5-en-2-yloxy)hexan-1-amine is sourced from PubChem (CID 144985063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).