About ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne
ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne (PubChem CID 144985081) has the molecular formula C19H29NO4
and a molecular weight of 335.44 g/mol. Its IUPAC name is ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne.
Molecular Properties
| Compound Name | ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne |
| PubChem CID | 144985081 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne |
| SMILES | C=C(OC)ON1C(=O)CCC1=O.CC.C[C@@]12CCC#CCC[C@@H]1C2 |
| InChI | InChI=1S/C10H14.C7H9NO4.C2H6/c1-10-7-5-3-2-4-6-9(10)8-10;1-5(11-2)12-8-6(9)3-4-7(8)10;1-2/h9H,4-8H2,1H3;1,3-4H2,2H3;1-2H3/t9-,10+;;/m1../s1 |
| InChIKey | WKRSMBMDHSCCBM-NKRBYZSKSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne?
The IUPAC name of ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne (CID 144985081) is ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne.
What is the SMILES notation for ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne?
The canonical SMILES for ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne is C=C(OC)ON1C(=O)CCC1=O.CC.C[C@@]12CCC#CCC[C@@H]1C2.
What is the InChIKey of ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne?
The InChIKey is WKRSMBMDHSCCBM-NKRBYZSKSA-N. The full InChI is InChI=1S/C10H14.C7H9NO4.C2H6/c1-10-7-5-3-2-4-6-9(10)8-10;1-5(11-2)12-8-6(9)3-4-7(8)10;1-2/h9H,4-8H2,1H3;1,3-4H2,2H3;1-2H3/t9-,10+;;/m1../s1.
What are the key properties of ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne?
ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne has a molecular weight of 335.44 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(1-methoxyethenoxy)pyrrolidine-2,5-dione;(1S,8R)-1-methylbicyclo[6.1.0]non-4-yne is sourced from PubChem (CID 144985081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).