C31H37NO3 — CID 144986038
N-[2-[2-(3-ethylphenyl)-4-(3-phenylmethoxycyclohexyl)oxyphenyl]ethyl]acetamide (PubChem CID 144986038) has the molecular formula C31H37NO3 and a molecular weight of 471.64 g/mol. Its IUPAC name is N-[2-[2-(3-ethylphenyl)-4-(3-phenylmethoxycyclohexyl)oxyphenyl]ethyl]acetamide.
| Compound Name | N-[2-[2-(3-ethylphenyl)-4-(3-phenylmethoxycyclohexyl)oxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 144986038 |
| Molecular Formula | C31H37NO3 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | N-[2-[2-(3-ethylphenyl)-4-(3-phenylmethoxycyclohexyl)oxyphenyl]ethyl]acetamide |
| SMILES | CCc1cccc(-c2cc(OC3CCCC(OCc4ccccc4)C3)ccc2CCNC(C)=O)c1 |
| InChI | InChI=1S/C31H37NO3/c1-3-24-11-7-12-27(19-24)31-21-30(16-15-26(31)17-18-32-23(2)33)35-29-14-8-13-28(20-29)34-22-25-9-5-4-6-10-25/h4-7,9-12,15-16,19,21,28-29H,3,8,13-14,17-18,20,22H2,1-2H3,(H,32,33) |
| InChIKey | OFIGFAPBVOIDJQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |