C14H23F3N4 — CID 144986482
N-(azetidin-3-yl)-6-tert-butyl-2-(trifluoromethyl)pyrimidin-4-amine;ethane (PubChem CID 144986482) has the molecular formula C14H23F3N4 and a molecular weight of 304.36 g/mol. Its IUPAC name is N-(azetidin-3-yl)-6-tert-butyl-2-(trifluoromethyl)pyrimidin-4-amine;ethane.
| Compound Name | N-(azetidin-3-yl)-6-tert-butyl-2-(trifluoromethyl)pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 144986482 |
| Molecular Formula | C14H23F3N4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-(azetidin-3-yl)-6-tert-butyl-2-(trifluoromethyl)pyrimidin-4-amine;ethane |
| SMILES | CC.CC(C)(C)c1cc(NC2CNC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4.C2H6/c1-11(2,3)8-4-9(17-7-5-16-6-7)19-10(18-8)12(13,14)15;1-2/h4,7,16H,5-6H2,1-3H3,(H,17,18,19);1-2H3 |
| InChIKey | BBTINTXVXHBXCW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |