About ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine
ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine (PubChem CID 144987049) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine.
Molecular Properties
| Compound Name | ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine |
| PubChem CID | 144987049 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine |
| SMILES | CC.NCC1=CCCc2cc(C3CCOCC3)ccc21 |
| InChI | InChI=1S/C16H21NO.C2H6/c17-11-15-3-1-2-14-10-13(4-5-16(14)15)12-6-8-18-9-7-12;1-2/h3-5,10,12H,1-2,6-9,11,17H2;1-2H3 |
| InChIKey | VJVCYBLHNQCJQR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine?
The IUPAC name of ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine (CID 144987049) is ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine.
What is the SMILES notation for ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine?
The canonical SMILES for ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine is CC.NCC1=CCCc2cc(C3CCOCC3)ccc21.
What is the InChIKey of ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine?
The InChIKey is VJVCYBLHNQCJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO.C2H6/c17-11-15-3-1-2-14-10-13(4-5-16(14)15)12-6-8-18-9-7-12;1-2/h3-5,10,12H,1-2,6-9,11,17H2;1-2H3.
What are the key properties of ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine?
ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine has a molecular weight of 273.42 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[6-(oxan-4-yl)-3,4-dihydronaphthalen-1-yl]methanamine is sourced from PubChem (CID 144987049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).