About N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane
N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane (PubChem CID 144987666) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane |
| PubChem CID | 144987666 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane |
| SMILES | CC.CN(C)CCC1(C)CCC1 |
| InChI | InChI=1S/C9H19N.C2H6/c1-9(5-4-6-9)7-8-10(2)3;1-2/h4-8H2,1-3H3;1-2H3 |
| InChIKey | BHVJBMIXUZOWHG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane?
The IUPAC name of N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane (CID 144987666) is N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane.
What is the SMILES notation for N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane?
The canonical SMILES for N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane is CC.CN(C)CCC1(C)CCC1.
What is the InChIKey of N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane?
The InChIKey is BHVJBMIXUZOWHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2H6/c1-9(5-4-6-9)7-8-10(2)3;1-2/h4-8H2,1-3H3;1-2H3.
What are the key properties of N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane?
N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane has a molecular weight of 171.33 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(1-methylcyclobutyl)ethanamine;ethane is sourced from PubChem (CID 144987666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).