About 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane
9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane (PubChem CID 144987858) has the molecular formula C21H26Cl2N2O
and a molecular weight of 393.36 g/mol. Its IUPAC name is 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane.
Molecular Properties
| Compound Name | 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane |
| PubChem CID | 144987858 |
| Molecular Formula | C21H26Cl2N2O |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane |
| SMILES | CC.COc1cc2c(cc1Cl)c1cc(Cl)ccc1n2C1CCCNCC1 |
| InChI | InChI=1S/C19H20Cl2N2O.C2H6/c1-24-19-11-18-15(10-16(19)21)14-9-12(20)4-5-17(14)23(18)13-3-2-7-22-8-6-13;1-2/h4-5,9-11,13,22H,2-3,6-8H2,1H3;1-2H3 |
| InChIKey | ZZLQEFNNOSKOPN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane?
The IUPAC name of 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane (CID 144987858) is 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane.
What is the SMILES notation for 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane?
The canonical SMILES for 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane is CC.COc1cc2c(cc1Cl)c1cc(Cl)ccc1n2C1CCCNCC1.
What is the InChIKey of 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane?
The InChIKey is ZZLQEFNNOSKOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O.C2H6/c1-24-19-11-18-15(10-16(19)21)14-9-12(20)4-5-17(14)23(18)13-3-2-7-22-8-6-13;1-2/h4-5,9-11,13,22H,2-3,6-8H2,1H3;1-2H3.
What are the key properties of 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane?
9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane has a molecular weight of 393.36 g/mol, XLogP of 6.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(azepan-4-yl)-3,6-dichloro-2-methoxycarbazole;ethane is sourced from PubChem (CID 144987858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).