C29H32N2O5 — CID 144988596
anisole;(10R)-3,5-dimethoxy-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one;ethane (PubChem CID 144988596) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is anisole;(10R)-3,5-dimethoxy-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one;ethane.
| Compound Name | anisole;(10R)-3,5-dimethoxy-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one;ethane |
|---|---|
| PubChem CID | 144988596 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | anisole;(10R)-3,5-dimethoxy-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one;ethane |
| SMILES | CC.COc1cc(OC)c2c(c1)OC1C2c2[nH][nH]c(=O)c2[C@H]1c1ccccc1.COc1ccccc1 |
| InChI | InChI=1S/C20H18N2O4.C7H8O.C2H6/c1-24-11-8-12(25-2)15-13(9-11)26-19-14(10-6-4-3-5-7-10)17-18(16(15)19)21-22-20(17)23;1-8-7-5-3-2-4-6-7;1-2/h3-9,14,16,19H,1-2H3,(H2,21,22,23);2-6H,1H3;1-2H3/t14-,16?,19?;;/m1../s1 |
| InChIKey | NKLQATAHZYFTEI-WFGYAUQASA-N |
| XLogP | 5.48 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |