C23H29NO5 — CID 144988653
4-ethoxy-N-(2-ethoxy-5-prop-1-en-2-ylphenyl)-3-methylbenzamide;methyl formate (PubChem CID 144988653) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-ethoxy-N-(2-ethoxy-5-prop-1-en-2-ylphenyl)-3-methylbenzamide;methyl formate.
| Compound Name | 4-ethoxy-N-(2-ethoxy-5-prop-1-en-2-ylphenyl)-3-methylbenzamide;methyl formate |
|---|---|
| PubChem CID | 144988653 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-ethoxy-N-(2-ethoxy-5-prop-1-en-2-ylphenyl)-3-methylbenzamide;methyl formate |
| SMILES | C=C(C)c1ccc(OCC)c(NC(=O)c2ccc(OCC)c(C)c2)c1.COC=O |
| InChI | InChI=1S/C21H25NO3.C2H4O2/c1-6-24-19-10-9-17(12-15(19)5)21(23)22-18-13-16(14(3)4)8-11-20(18)25-7-2;1-4-2-3/h8-13H,3,6-7H2,1-2,4-5H3,(H,22,23);2H,1H3 |
| InChIKey | WGTNKAPYPBBMTH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|