C23H35N — CID 144989008
N-[(3E,5E)-5-ethyl-3-methylocta-3,5,7-trien-4-yl]-2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)butan-1-imine (PubChem CID 144989008) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is N-[(3E,5E)-5-ethyl-3-methylocta-3,5,7-trien-4-yl]-2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)butan-1-imine.
| Compound Name | N-[(3E,5E)-5-ethyl-3-methylocta-3,5,7-trien-4-yl]-2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)butan-1-imine |
|---|---|
| PubChem CID | 144989008 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | N-[(3E,5E)-5-ethyl-3-methylocta-3,5,7-trien-4-yl]-2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)butan-1-imine |
| SMILES | C=C/C=C(CC)/C(/N=C(/C1=CCCC=C1C)C(C)CC)=C(/C)CC |
| InChI | InChI=1S/C23H35N/c1-8-14-20(11-4)22(17(5)9-2)24-23(18(6)10-3)21-16-13-12-15-19(21)7/h8,14-16,18H,1,9-13H2,2-7H3/b20-14+,22-17+,24-23+ |
| InChIKey | MUBMXTRKWGAVMA-JEEVEPOSSA-N |
| XLogP | 7.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|