C14H26BrNO — CID 144989160
4-bromo-1-(3,3-dimethylazetidin-1-yl)-2,2,4-trimethylhexan-1-one (PubChem CID 144989160) has the molecular formula C14H26BrNO and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-bromo-1-(3,3-dimethylazetidin-1-yl)-2,2,4-trimethylhexan-1-one.
| Compound Name | 4-bromo-1-(3,3-dimethylazetidin-1-yl)-2,2,4-trimethylhexan-1-one |
|---|---|
| PubChem CID | 144989160 |
| Molecular Formula | C14H26BrNO |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-bromo-1-(3,3-dimethylazetidin-1-yl)-2,2,4-trimethylhexan-1-one |
| SMILES | CCC(C)(Br)CC(C)(C)C(=O)N1CC(C)(C)C1 |
| InChI | InChI=1S/C14H26BrNO/c1-7-14(6,15)8-13(4,5)11(17)16-9-12(2,3)10-16/h7-10H2,1-6H3 |
| InChIKey | NXTRDOODANLPHT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|