C13H10O — CID 144989374
1-(6,7-didehydro-5H-benzo[7]annulen-4-yl)ethanone (PubChem CID 144989374) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(6,7-didehydro-5H-benzo[7]annulen-4-yl)ethanone.
| Compound Name | 1-(6,7-didehydro-5H-benzo[7]annulen-4-yl)ethanone |
|---|---|
| PubChem CID | 144989374 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-(6,7-didehydro-5H-benzo[7]annulen-4-yl)ethanone |
| SMILES | CC(=O)c1cccc2c1CC#CC=C2 |
| InChI | InChI=1S/C13H10O/c1-10(14)12-9-5-7-11-6-3-2-4-8-13(11)12/h3,5-7,9H,8H2,1H3 |
| InChIKey | HFHQLXHWFWMDNN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|