C52H41N5 — CID 144989697
azane;8-[3-[4-(4,5-dimethylphenanthren-1-yl)phenyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dihydroquinoline (PubChem CID 144989697) has the molecular formula C52H41N5 and a molecular weight of 735.94 g/mol. Its IUPAC name is azane;8-[3-[4-(4,5-dimethylphenanthren-1-yl)phenyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dihydroquinoline.
| Compound Name | azane;8-[3-[4-(4,5-dimethylphenanthren-1-yl)phenyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 144989697 |
| Molecular Formula | C52H41N5 |
| Molecular Weight | 735.94 g/mol |
| Exact Mass | 735.34 |
| IUPAC Name | azane;8-[3-[4-(4,5-dimethylphenanthren-1-yl)phenyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dihydroquinoline |
| SMILES | Cc1cccc2ccc3c(-c4ccc(-c5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc(-c6cccc7c6N=CCC7)c5)cc4)ccc(C)c3c12.N |
| InChI | InChI=1S/C52H38N4.H3N/c1-33-12-9-17-37-26-28-46-44(27-21-34(2)48(46)47(33)37)36-24-22-35(23-25-36)41-30-42(45-20-10-18-38-19-11-29-53-49(38)45)32-43(31-41)52-55-50(39-13-5-3-6-14-39)54-51(56-52)40-15-7-4-8-16-40;/h3-10,12-18,20-32H,11,19H2,1-2H3;1H3 |
| InChIKey | STNLEMONVLKVHP-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.94 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|