C18H24F3N7O — CID 144990599
1-[4-[[(Z)-1,3-diamino-4,4,4-trifluorobut-2-enylidene]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 144990599) has the molecular formula C18H24F3N7O and a molecular weight of 411.43 g/mol. Its IUPAC name is 1-[4-[[(Z)-1,3-diamino-4,4,4-trifluorobut-2-enylidene]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[4-[[(Z)-1,3-diamino-4,4,4-trifluorobut-2-enylidene]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144990599 |
| Molecular Formula | C18H24F3N7O |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-[4-[[(Z)-1,3-diamino-4,4,4-trifluorobut-2-enylidene]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1c1nc2c(c(/N=C(N)/C=C(\N)C(F)(F)F)n1)CCC2 |
| InChI | InChI=1S/C18H24F3N7O/c1-27(2)16(29)12-7-4-8-28(12)17-24-11-6-3-5-10(11)15(26-17)25-14(23)9-13(22)18(19,20)21/h9,12H,3-8,22H2,1-2H3,(H2,23,24,25,26)/b13-9- |
| InChIKey | OXUGUNJUGRZYNS-LCYFTJDESA-N |
| XLogP | 1.42 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|