C12H19NO3 — CID 144990982
ethane;2-hydroxy-4-methoxy-N,N-dimethylbenzamide (PubChem CID 144990982) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethane;2-hydroxy-4-methoxy-N,N-dimethylbenzamide.
| Compound Name | ethane;2-hydroxy-4-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 144990982 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethane;2-hydroxy-4-methoxy-N,N-dimethylbenzamide |
| SMILES | CC.COc1ccc(C(=O)N(C)C)c(O)c1 |
| InChI | InChI=1S/C10H13NO3.C2H6/c1-11(2)10(13)8-5-4-7(14-3)6-9(8)12;1-2/h4-6,12H,1-3H3;1-2H3 |
| InChIKey | SNZXMMPIGZFLNE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |