C11H20F3NO — CID 144991210
[[(Z)-8,8,8-trifluoro-2,7-dimethyloct-6-enyl]amino]methanol (PubChem CID 144991210) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is [[(Z)-8,8,8-trifluoro-2,7-dimethyloct-6-enyl]amino]methanol.
| Compound Name | [[(Z)-8,8,8-trifluoro-2,7-dimethyloct-6-enyl]amino]methanol |
|---|---|
| PubChem CID | 144991210 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [[(Z)-8,8,8-trifluoro-2,7-dimethyloct-6-enyl]amino]methanol |
| SMILES | C/C(=C/CCCC(C)CNCO)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-9(7-15-8-16)5-3-4-6-10(2)11(12,13)14/h6,9,15-16H,3-5,7-8H2,1-2H3/b10-6- |
| InChIKey | SSCDMWKABFWVAL-POHAHGRESA-N |
| XLogP | 2.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|