C18H19FN4O2 — CID 144991223
[2-[4-(2-aminoethyl)phenyl]-5-fluoro-1-(6-methoxy-3-pyridinyl)imidazol-4-yl]methanol (PubChem CID 144991223) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is [2-[4-(2-aminoethyl)phenyl]-5-fluoro-1-(6-methoxy-3-pyridinyl)imidazol-4-yl]methanol.
| Compound Name | [2-[4-(2-aminoethyl)phenyl]-5-fluoro-1-(6-methoxy-3-pyridinyl)imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 144991223 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [2-[4-(2-aminoethyl)phenyl]-5-fluoro-1-(6-methoxy-3-pyridinyl)imidazol-4-yl]methanol |
| SMILES | COc1ccc(-n2c(-c3ccc(CCN)cc3)nc(CO)c2F)cn1 |
| InChI | InChI=1S/C18H19FN4O2/c1-25-16-7-6-14(10-21-16)23-17(19)15(11-24)22-18(23)13-4-2-12(3-5-13)8-9-20/h2-7,10,24H,8-9,11,20H2,1H3 |
| InChIKey | WOGYUFVHDXCCCY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |