C13H19N — CID 144991434
(4S)-4-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 144991434) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (4S)-4-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | (4S)-4-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 144991434 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (4S)-4-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | C/C=C\C=C/C(=C\C)C1=NCC[C@@H]1C |
| InChI | InChI=1S/C13H19N/c1-4-6-7-8-12(5-2)13-11(3)9-10-14-13/h4-8,11H,9-10H2,1-3H3/b6-4-,8-7-,12-5+/t11-/m0/s1 |
| InChIKey | ZVLBNONTUMYMQC-MRODQPBOSA-N |
| XLogP | 3.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|