C25H45NO5Si — CID 14499161
[(1S,3S,4aS,7S,8S,8aS)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] nitrite (PubChem CID 14499161) has the molecular formula C25H45NO5Si and a molecular weight of 467.72 g/mol. Its IUPAC name is [(1S,3S,4aS,7S,8S,8aS)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] nitrite.
| Compound Name | [(1S,3S,4aS,7S,8S,8aS)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] nitrite |
|---|---|
| PubChem CID | 14499161 |
| Molecular Formula | C25H45NO5Si |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | [(1S,3S,4aS,7S,8S,8aS)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] nitrite |
| SMILES | C[C@H]1C[C@@H]2CC[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]2[C@@H](ON=O)C1 |
| InChI | InChI=1S/C25H45NO5Si/c1-16-12-18-9-8-17(2)21(24(18)22(13-16)30-26-28)11-10-19-14-20(15-23(27)29-19)31-32(6,7)25(3,4)5/h16-22,24H,8-15H2,1-7H3/t16-,17-,18-,19+,20+,21-,22-,24-/m0/s1 |
| InChIKey | HWLFZMXMBBJSCD-YHTFOKLHSA-N |
| XLogP | 6.64 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|