C25H46O5Si — CID 14499169
(4R,6R)-6-[2-[(1S,2S,4aS,6S,8S,8aS)-8-hydroxy-6-(hydroxymethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one (PubChem CID 14499169) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is (4R,6R)-6-[2-[(1S,2S,4aS,6S,8S,8aS)-8-hydroxy-6-(hydroxymethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one.
| Compound Name | (4R,6R)-6-[2-[(1S,2S,4aS,6S,8S,8aS)-8-hydroxy-6-(hydroxymethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
|---|---|
| PubChem CID | 14499169 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (4R,6R)-6-[2-[(1S,2S,4aS,6S,8S,8aS)-8-hydroxy-6-(hydroxymethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
| SMILES | C[C@H]1CC[C@H]2C[C@H](CO)C[C@H](O)[C@@H]2[C@H]1CC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C25H46O5Si/c1-16-7-8-18-11-17(15-26)12-22(27)24(18)21(16)10-9-19-13-20(14-23(28)29-19)30-31(5,6)25(2,3)4/h16-22,24,26-27H,7-15H2,1-6H3/t16-,17-,18-,19+,20+,21-,22-,24-/m0/s1 |
| InChIKey | AGCHKVOCTBVUIX-YHTFOKLHSA-N |
| XLogP | 4.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|