C33H37N7O3S — CID 144992221
4-[[2-amino-3-[[1-[(E)-4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]carbamothioyl]-4-pyridinyl]oxy]-N-(4-cyclopropyl-2-pyridinyl)benzamide (PubChem CID 144992221) has the molecular formula C33H37N7O3S and a molecular weight of 611.77 g/mol. Its IUPAC name is 4-[[2-amino-3-[[1-[(E)-4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]carbamothioyl]-4-pyridinyl]oxy]-N-(4-cyclopropyl-2-pyridinyl)benzamide.
| Compound Name | 4-[[2-amino-3-[[1-[(E)-4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]carbamothioyl]-4-pyridinyl]oxy]-N-(4-cyclopropyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 144992221 |
| Molecular Formula | C33H37N7O3S |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 4-[[2-amino-3-[[1-[(E)-4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]carbamothioyl]-4-pyridinyl]oxy]-N-(4-cyclopropyl-2-pyridinyl)benzamide |
| SMILES | CN(C/C=C/C(=O)N1CCC(NC(=S)c2c(Oc3ccc(C(=O)Nc4cc(C5CC5)ccn4)cc3)ccnc2N)C1)C1CC1 |
| InChI | InChI=1S/C33H37N7O3S/c1-39(25-8-9-25)17-2-3-29(41)40-18-14-24(20-40)37-33(44)30-27(13-16-36-31(30)34)43-26-10-6-22(7-11-26)32(42)38-28-19-23(12-15-35-28)21-4-5-21/h2-3,6-7,10-13,15-16,19,21,24-25H,4-5,8-9,14,17-18,20H2,1H3,(H2,34,36)(H,37,44)(H,35,38,42)/b3-2+ |
| InChIKey | CSOQSRHHVVIQBK-NSCUHMNNSA-N |
| XLogP | 4.50 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|