C26H28ClF3N8O3 — CID 144992667
(Z)-2-amino-3-[amino-[4-[6-[[2-[4-[3-chloro-2-(trifluoromethoxy)phenyl]-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide (PubChem CID 144992667) has the molecular formula C26H28ClF3N8O3 and a molecular weight of 593.01 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[4-[6-[[2-[4-[3-chloro-2-(trifluoromethoxy)phenyl]-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[4-[6-[[2-[4-[3-chloro-2-(trifluoromethoxy)phenyl]-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 144992667 |
| Molecular Formula | C26H28ClF3N8O3 |
| Molecular Weight | 593.01 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | (Z)-2-amino-3-[amino-[4-[6-[[2-[4-[3-chloro-2-(trifluoromethoxy)phenyl]-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(N)=C/N(N)CCCCc1ccc(NC(=O)Cc2cc(-c3cccc(Cl)c3OC(F)(F)F)ccn2)nn1 |
| InChI | InChI=1S/C26H28ClF3N8O3/c1-33-25(40)21(31)15-38(32)12-3-2-5-17-8-9-22(37-36-17)35-23(39)14-18-13-16(10-11-34-18)19-6-4-7-20(27)24(19)41-26(28,29)30/h4,6-11,13,15H,2-3,5,12,14,31-32H2,1H3,(H,33,40)(H,35,37,39)/b21-15- |
| InChIKey | PWPIJTKOVCMWME-QNGOZBTKSA-N |
| XLogP | 3.32 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.01 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|