About (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine
(3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine (PubChem CID 144992804) has the molecular formula C8H11F3N2
and a molecular weight of 192.18 g/mol. Its IUPAC name is (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine |
| PubChem CID | 144992804 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine |
| SMILES | C=C/C(=C\C(CN)=N\C)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c1-3-6(8(9,10)11)4-7(5-12)13-2/h3-4H,1,5,12H2,2H3/b6-4+,13-7- |
| InChIKey | SWLLVWPMSBZMHD-VKIZFATHSA-N |
| XLogP | 1.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine?
The IUPAC name of (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine (CID 144992804) is (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine.
What is the SMILES notation for (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine?
The canonical SMILES for (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine is C=C/C(=C\C(CN)=N\C)C(F)(F)F.
What is the InChIKey of (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine?
The InChIKey is SWLLVWPMSBZMHD-VKIZFATHSA-N. The full InChI is InChI=1S/C8H11F3N2/c1-3-6(8(9,10)11)4-7(5-12)13-2/h3-4H,1,5,12H2,2H3/b6-4+,13-7-.
What are the key properties of (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine?
(3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine has a molecular weight of 192.18 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dien-1-amine is sourced from PubChem (CID 144992804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).