C28H38ClF3N6O3 — CID 144993176
N-[1-[4-[amino-[(Z)-2-aminoprop-1-enyl]amino]-3-fluorobutyl]-3-fluoro-2-oxo-4-pyridinyl]-2-cyclohexylacetamide;N-[(5-chloro-2-fluorophenyl)methyl]formamide (PubChem CID 144993176) has the molecular formula C28H38ClF3N6O3 and a molecular weight of 599.10 g/mol. Its IUPAC name is N-[1-[4-[amino-[(Z)-2-aminoprop-1-enyl]amino]-3-fluorobutyl]-3-fluoro-2-oxo-4-pyridinyl]-2-cyclohexylacetamide;N-[(5-chloro-2-fluorophenyl)methyl]formamide.
| Compound Name | N-[1-[4-[amino-[(Z)-2-aminoprop-1-enyl]amino]-3-fluorobutyl]-3-fluoro-2-oxo-4-pyridinyl]-2-cyclohexylacetamide;N-[(5-chloro-2-fluorophenyl)methyl]formamide |
|---|---|
| PubChem CID | 144993176 |
| Molecular Formula | C28H38ClF3N6O3 |
| Molecular Weight | 599.10 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | N-[1-[4-[amino-[(Z)-2-aminoprop-1-enyl]amino]-3-fluorobutyl]-3-fluoro-2-oxo-4-pyridinyl]-2-cyclohexylacetamide;N-[(5-chloro-2-fluorophenyl)methyl]formamide |
| SMILES | C/C(N)=C/N(N)CC(F)CCn1ccc(NC(=O)CC2CCCCC2)c(F)c1=O.O=CNCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C20H31F2N5O2.C8H7ClFNO/c1-14(23)12-27(24)13-16(21)7-9-26-10-8-17(19(22)20(26)29)25-18(28)11-15-5-3-2-4-6-15;9-7-1-2-8(10)6(3-7)4-11-5-12/h8,10,12,15-16H,2-7,9,11,13,23-24H2,1H3,(H,25,28);1-3,5H,4H2,(H,11,12)/b14-12-; |
| InChIKey | PHOSXVGHNNSYTH-CTMPBGLUSA-N |
| XLogP | 4.35 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.10 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|