C27H29F3N6O4S — CID 144993293
N-[1-[4-(4-methyltriazol-1-yl)butyl]-2-oxo-4-pyridinyl]-2-thiophen-2-ylacetamide;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide (PubChem CID 144993293) has the molecular formula C27H29F3N6O4S and a molecular weight of 590.63 g/mol. Its IUPAC name is N-[1-[4-(4-methyltriazol-1-yl)butyl]-2-oxo-4-pyridinyl]-2-thiophen-2-ylacetamide;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide.
| Compound Name | N-[1-[4-(4-methyltriazol-1-yl)butyl]-2-oxo-4-pyridinyl]-2-thiophen-2-ylacetamide;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 144993293 |
| Molecular Formula | C27H29F3N6O4S |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | N-[1-[4-(4-methyltriazol-1-yl)butyl]-2-oxo-4-pyridinyl]-2-thiophen-2-ylacetamide;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide |
| SMILES | Cc1cn(CCCCn2ccc(NC(=O)Cc3cccs3)cc2=O)nn1.O=CNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H21N5O2S.C9H8F3NO2/c1-14-13-23(21-20-14)8-3-2-7-22-9-6-15(11-18(22)25)19-17(24)12-16-5-4-10-26-16;10-9(11,12)15-8-3-1-2-7(4-8)5-13-6-14/h4-6,9-11,13H,2-3,7-8,12H2,1H3,(H,19,24);1-4,6H,5H2,(H,13,14) |
| InChIKey | OBWMELFSWINYEF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|