C22H32O6 — CID 144993692
[(3Z,7S,8R,9Z,12R)-12-[(Z)-but-2-en-2-yl]-8-hydroxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-3,9-dien-7-yl] 3-methylbutanoate (PubChem CID 144993692) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [(3Z,7S,8R,9Z,12R)-12-[(Z)-but-2-en-2-yl]-8-hydroxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-3,9-dien-7-yl] 3-methylbutanoate.
| Compound Name | [(3Z,7S,8R,9Z,12R)-12-[(Z)-but-2-en-2-yl]-8-hydroxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-3,9-dien-7-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 144993692 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(3Z,7S,8R,9Z,12R)-12-[(Z)-but-2-en-2-yl]-8-hydroxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-3,9-dien-7-yl] 3-methylbutanoate |
| SMILES | C/C=C(/C)[C@H]1C/C=C(/C)[C@@H](O)[C@H](OC(=O)CC(C)C)C(=O)C/C=C(/C)C(=O)O1 |
| InChI | InChI=1S/C22H32O6/c1-7-14(4)18-11-9-15(5)20(25)21(28-19(24)12-13(2)3)17(23)10-8-16(6)22(26)27-18/h7-9,13,18,20-21,25H,10-12H2,1-6H3/b14-7-,15-9-,16-8-/t18-,20-,21-/m1/s1 |
| InChIKey | MWIOGDLEOXIEIS-SAOPTEGRSA-N |
| XLogP | 3.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|