About 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one
6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one (PubChem CID 14499378) has the molecular formula C16H13ClFN3O2
and a molecular weight of 333.75 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| PubChem CID | 14499378 |
| Molecular Formula | C16H13ClFN3O2 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)COc2cc(F)c(-n3nc(C)c(Cl)c3C)cc21 |
| InChI | InChI=1S/C16H13ClFN3O2/c1-4-5-20-13-7-12(21-10(3)16(17)9(2)19-21)11(18)6-14(13)23-8-15(20)22/h1,6-7H,5,8H2,2-3H3 |
| InChIKey | DMAAZGZHMDOKJN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one?
The IUPAC name of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one (CID 14499378) is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one is C#CCN1C(=O)COc2cc(F)c(-n3nc(C)c(Cl)c3C)cc21.
What is the InChIKey of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one?
The InChIKey is DMAAZGZHMDOKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClFN3O2/c1-4-5-20-13-7-12(21-10(3)16(17)9(2)19-21)11(18)6-14(13)23-8-15(20)22/h1,6-7H,5,8H2,2-3H3.
What are the key properties of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one?
6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one has a molecular weight of 333.75 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 14499378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).