About 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane
4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane (PubChem CID 144994309) has the molecular formula C10H13F3N2
and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane.
Molecular Properties
| Compound Name | 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane |
| PubChem CID | 144994309 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane |
| SMILES | CC.N#CC1C=CC(N)=CC1C(F)(F)F |
| InChI | InChI=1S/C8H7F3N2.C2H6/c9-8(10,11)7-3-6(13)2-1-5(7)4-12;1-2/h1-3,5,7H,13H2;1-2H3 |
| InChIKey | QGSTWSMBHGJZRL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane?
The IUPAC name of 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane (CID 144994309) is 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane.
What is the SMILES notation for 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane?
The canonical SMILES for 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane is CC.N#CC1C=CC(N)=CC1C(F)(F)F.
What is the InChIKey of 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane?
The InChIKey is QGSTWSMBHGJZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2.C2H6/c9-8(10,11)7-3-6(13)2-1-5(7)4-12;1-2/h1-3,5,7H,13H2;1-2H3.
What are the key properties of 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane?
4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane has a molecular weight of 218.22 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonitrile;ethane is sourced from PubChem (CID 144994309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).