C16H18N2S2 — CID 144994363
4,9-dimethyl-5,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,14-hexaene;ethane (PubChem CID 144994363) has the molecular formula C16H18N2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 4,9-dimethyl-5,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,14-hexaene;ethane.
| Compound Name | 4,9-dimethyl-5,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,14-hexaene;ethane |
|---|---|
| PubChem CID | 144994363 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4,9-dimethyl-5,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,14-hexaene;ethane |
| SMILES | CC.Cc1cc2c3c(c4cc(C)sc4c2s1)NC=CN3 |
| InChI | InChI=1S/C14H12N2S2.C2H6/c1-7-5-9-11-12(16-4-3-15-11)10-6-8(2)18-14(10)13(9)17-7;1-2/h3-6,15-16H,1-2H3;1-2H3 |
| InChIKey | YQPCEFHYPAOBJZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |