About (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate
(1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate (PubChem CID 144994542) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate |
| PubChem CID | 144994542 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate |
| SMILES | CCC(CC(C)(C)C)C(=O)OC1(C(C)(C)C)CC(C)CC1C |
| InChI | InChI=1S/C20H38O2/c1-10-16(13-18(4,5)6)17(21)22-20(19(7,8)9)12-14(2)11-15(20)3/h14-16H,10-13H2,1-9H3 |
| InChIKey | DSRQUHLVXVKJKN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate?
The IUPAC name of (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate (CID 144994542) is (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate.
What is the SMILES notation for (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate?
The canonical SMILES for (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate is CCC(CC(C)(C)C)C(=O)OC1(C(C)(C)C)CC(C)CC1C.
What is the InChIKey of (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate?
The InChIKey is DSRQUHLVXVKJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-10-16(13-18(4,5)6)17(21)22-20(19(7,8)9)12-14(2)11-15(20)3/h14-16H,10-13H2,1-9H3.
What are the key properties of (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate?
(1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate has a molecular weight of 310.52 g/mol, XLogP of 5.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-2,4-dimethylcyclopentyl) 2-ethyl-4,4-dimethylpentanoate is sourced from PubChem (CID 144994542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).