C22H26N4O4 — CID 144994892
N-[3-(hydroxyamino)phenyl]-2-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide (PubChem CID 144994892) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[3-(hydroxyamino)phenyl]-2-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-[3-(hydroxyamino)phenyl]-2-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 144994892 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[3-(hydroxyamino)phenyl]-2-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide |
| SMILES | O=C(CN1CC(C(=O)N2CCCCC2)Oc2ccccc21)Nc1cccc(NO)c1 |
| InChI | InChI=1S/C22H26N4O4/c27-21(23-16-7-6-8-17(13-16)24-29)15-26-14-20(22(28)25-11-4-1-5-12-25)30-19-10-3-2-9-18(19)26/h2-3,6-10,13,20,24,29H,1,4-5,11-12,14-15H2,(H,23,27) |
| InChIKey | DDDBUBPVZQKVMI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|