C23H28ClN3O2 — CID 144994904
2-[2-(3-chlorophenyl)ethylamino]-1-[2-[1-(propylamino)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone (PubChem CID 144994904) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethylamino]-1-[2-[1-(propylamino)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone.
| Compound Name | 2-[2-(3-chlorophenyl)ethylamino]-1-[2-[1-(propylamino)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 144994904 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethylamino]-1-[2-[1-(propylamino)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
| SMILES | C=C(NCCC)C1CN(C(=O)CNCCc2cccc(Cl)c2)c2ccccc2O1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-3-12-26-17(2)22-16-27(20-9-4-5-10-21(20)29-22)23(28)15-25-13-11-18-7-6-8-19(24)14-18/h4-10,14,22,25-26H,2-3,11-13,15-16H2,1H3 |
| InChIKey | YRMPXOXGPNSTAF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|