About 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide
8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 144994913) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
Molecular Properties
| Compound Name | 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| PubChem CID | 144994913 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | CCCNC(=O)C1CNc2cccc(C)c2O1 |
| InChI | InChI=1S/C13H18N2O2/c1-3-7-14-13(16)11-8-15-10-6-4-5-9(2)12(10)17-11/h4-6,11,15H,3,7-8H2,1-2H3,(H,14,16) |
| InChIKey | AOXYCYZPEGMFMW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide?
The IUPAC name of 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (CID 144994913) is 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
What is the SMILES notation for 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide?
The canonical SMILES for 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide is CCCNC(=O)C1CNc2cccc(C)c2O1.
What is the InChIKey of 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide?
The InChIKey is AOXYCYZPEGMFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-3-7-14-13(16)11-8-15-10-6-4-5-9(2)12(10)17-11/h4-6,11,15H,3,7-8H2,1-2H3,(H,14,16).
What are the key properties of 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide?
8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide has a molecular weight of 234.30 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide is sourced from PubChem (CID 144994913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).