C22H28ClN3O3 — CID 144994941
N-(3-chlorophenyl)formamide;4-ethyl-7-methyl-N-propyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 144994941) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is N-(3-chlorophenyl)formamide;4-ethyl-7-methyl-N-propyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)formamide;4-ethyl-7-methyl-N-propyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 144994941 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(3-chlorophenyl)formamide;4-ethyl-7-methyl-N-propyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCCNC(=O)C1CN(CC)c2ccc(C)cc2O1.O=CNc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22N2O2.C7H6ClNO/c1-4-8-16-15(18)14-10-17(5-2)12-7-6-11(3)9-13(12)19-14;8-6-2-1-3-7(4-6)9-5-10/h6-7,9,14H,4-5,8,10H2,1-3H3,(H,16,18);1-5H,(H,9,10) |
| InChIKey | GGZIWJPGQOXSBQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|