C31H49NO5 — CID 144994961
N-(2,4-dimethoxy-5-methylphenyl)propanamide;heptane;3-(2-methylphenoxy)pentan-2-one (PubChem CID 144994961) has the molecular formula C31H49NO5 and a molecular weight of 515.74 g/mol. Its IUPAC name is N-(2,4-dimethoxy-5-methylphenyl)propanamide;heptane;3-(2-methylphenoxy)pentan-2-one.
| Compound Name | N-(2,4-dimethoxy-5-methylphenyl)propanamide;heptane;3-(2-methylphenoxy)pentan-2-one |
|---|---|
| PubChem CID | 144994961 |
| Molecular Formula | C31H49NO5 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | N-(2,4-dimethoxy-5-methylphenyl)propanamide;heptane;3-(2-methylphenoxy)pentan-2-one |
| SMILES | CCC(=O)Nc1cc(C)c(OC)cc1OC.CCC(Oc1ccccc1C)C(C)=O.CCCCCCC |
| InChI | InChI=1S/C12H17NO3.C12H16O2.C7H16/c1-5-12(14)13-9-6-8(2)10(15-3)7-11(9)16-4;1-4-11(10(3)13)14-12-8-6-5-7-9(12)2;1-3-5-7-6-4-2/h6-7H,5H2,1-4H3,(H,13,14);5-8,11H,4H2,1-3H3;3-7H2,1-2H3 |
| InChIKey | WBERSXFLAIFKCI-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|