C45H34N2 — CID 144995257
2-[(1Z)-buta-1,3-dienyl]-1-(3-carbazol-9-ylphenyl)-3-ethenyl-5-[2-[(E)-prop-1-enyl]phenyl]benzo[de]quinoline (PubChem CID 144995257) has the molecular formula C45H34N2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-(3-carbazol-9-ylphenyl)-3-ethenyl-5-[2-[(E)-prop-1-enyl]phenyl]benzo[de]quinoline.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-(3-carbazol-9-ylphenyl)-3-ethenyl-5-[2-[(E)-prop-1-enyl]phenyl]benzo[de]quinoline |
|---|---|
| PubChem CID | 144995257 |
| Molecular Formula | C45H34N2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-(3-carbazol-9-ylphenyl)-3-ethenyl-5-[2-[(E)-prop-1-enyl]phenyl]benzo[de]quinoline |
| SMILES | C=C/C=C\C1=C(C=C)c2cc(-c3ccccc3/C=C/C)cc3cccc(c23)N1c1cccc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C45H34N2/c1-4-7-24-41-36(6-3)40-29-33(37-21-9-8-17-31(37)16-5-2)28-32-18-14-27-44(45(32)40)47(41)35-20-15-19-34(30-35)46-42-25-12-10-22-38(42)39-23-11-13-26-43(39)46/h4-30H,1,3H2,2H3/b16-5+,24-7- |
| InChIKey | PAQLZNHEFPYMPG-MPZARZMQSA-N |
| XLogP | 12.43 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|