About 2-(2-iodophenyl)-1,3-dimethylpyrrole
2-(2-iodophenyl)-1,3-dimethylpyrrole (PubChem CID 144995528) has the molecular formula C12H12IN
and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-(2-iodophenyl)-1,3-dimethylpyrrole.
Molecular Properties
| Compound Name | 2-(2-iodophenyl)-1,3-dimethylpyrrole |
| PubChem CID | 144995528 |
| Molecular Formula | C12H12IN |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-(2-iodophenyl)-1,3-dimethylpyrrole |
| SMILES | Cc1ccn(C)c1-c1ccccc1I |
| InChI | InChI=1S/C12H12IN/c1-9-7-8-14(2)12(9)10-5-3-4-6-11(10)13/h3-8H,1-2H3 |
| InChIKey | YGNXIUNBSGDZQT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodophenyl)-1,3-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodophenyl)-1,3-dimethylpyrrole?
The IUPAC name of 2-(2-iodophenyl)-1,3-dimethylpyrrole (CID 144995528) is 2-(2-iodophenyl)-1,3-dimethylpyrrole.
What is the SMILES notation for 2-(2-iodophenyl)-1,3-dimethylpyrrole?
The canonical SMILES for 2-(2-iodophenyl)-1,3-dimethylpyrrole is Cc1ccn(C)c1-c1ccccc1I.
What is the InChIKey of 2-(2-iodophenyl)-1,3-dimethylpyrrole?
The InChIKey is YGNXIUNBSGDZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12IN/c1-9-7-8-14(2)12(9)10-5-3-4-6-11(10)13/h3-8H,1-2H3.
What are the key properties of 2-(2-iodophenyl)-1,3-dimethylpyrrole?
2-(2-iodophenyl)-1,3-dimethylpyrrole has a molecular weight of 297.14 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodophenyl)-1,3-dimethylpyrrole is sourced from PubChem (CID 144995528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).